C79H58Si — CID 59391113
trimethyl-[4-[3,6,8-tris(3,5-diphenylphenyl)pyren-1-yl]phenyl]silane (PubChem CID 59391113) has the molecular formula C79H58Si and a molecular weight of 1035.42 g/mol. Its IUPAC name is trimethyl-[4-[3,6,8-tris(3,5-diphenylphenyl)pyren-1-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[3,6,8-tris(3,5-diphenylphenyl)pyren-1-yl]phenyl]silane |
|---|---|
| PubChem CID | 59391113 |
| Molecular Formula | C79H58Si |
| Molecular Weight | 1035.42 g/mol |
| Exact Mass | 1034.43 |
| IUPAC Name | trimethyl-[4-[3,6,8-tris(3,5-diphenylphenyl)pyren-1-yl]phenyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3ccc4c(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)cc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C79H58Si/c1-80(2,3)69-36-34-59(35-37-69)74-51-75(66-45-60(53-22-10-4-11-23-53)42-61(46-66)54-24-12-5-13-25-54)71-40-41-73-77(68-49-64(57-30-18-8-19-31-57)44-65(50-68)58-32-20-9-21-33-58)52-76(72-39-38-70(74)78(71)79(72)73)67-47-62(55-26-14-6-15-27-55)43-63(48-67)56-28-16-7-17-29-56/h4-52H,1-3H3 |
| InChIKey | CIEUQLQJXNNBEQ-UHFFFAOYSA-N |
| XLogP | 21.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.42 |
| LogP ≤ 5 | 21.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|