C54H62Si4 — CID 59391032
[3-[6-[3,5-bis(trimethylsilyl)phenyl]-3,8-bis(4-methylphenyl)pyren-1-yl]-5-trimethylsilylphenyl]-trimethylsilane (PubChem CID 59391032) has the molecular formula C54H62Si4 and a molecular weight of 823.43 g/mol. Its IUPAC name is [3-[6-[3,5-bis(trimethylsilyl)phenyl]-3,8-bis(4-methylphenyl)pyren-1-yl]-5-trimethylsilylphenyl]-trimethylsilane.
| Compound Name | [3-[6-[3,5-bis(trimethylsilyl)phenyl]-3,8-bis(4-methylphenyl)pyren-1-yl]-5-trimethylsilylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 59391032 |
| Molecular Formula | C54H62Si4 |
| Molecular Weight | 823.43 g/mol |
| Exact Mass | 822.39 |
| IUPAC Name | [3-[6-[3,5-bis(trimethylsilyl)phenyl]-3,8-bis(4-methylphenyl)pyren-1-yl]-5-trimethylsilylphenyl]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc(-c3cc([Si](C)(C)C)cc([Si](C)(C)C)c3)c3ccc4c(-c5ccc(C)cc5)cc(-c5cc([Si](C)(C)C)cc([Si](C)(C)C)c5)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C54H62Si4/c1-35-15-19-37(20-16-35)49-33-51(39-27-41(55(3,4)5)31-42(28-39)56(6,7)8)47-26-24-46-50(38-21-17-36(2)18-22-38)34-52(48-25-23-45(49)53(47)54(46)48)40-29-43(57(9,10)11)32-44(30-40)58(12,13)14/h15-34H,1-14H3 |
| InChIKey | LBNOIGUUNDCEFX-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.43 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|