C50H49NSi3 — CID 59391192
4-[3,6,8-tris(4-trimethylsilylphenyl)pyren-1-yl]benzonitrile (PubChem CID 59391192) has the molecular formula C50H49NSi3 and a molecular weight of 748.21 g/mol. Its IUPAC name is 4-[3,6,8-tris(4-trimethylsilylphenyl)pyren-1-yl]benzonitrile.
| Compound Name | 4-[3,6,8-tris(4-trimethylsilylphenyl)pyren-1-yl]benzonitrile |
|---|---|
| PubChem CID | 59391192 |
| Molecular Formula | C50H49NSi3 |
| Molecular Weight | 748.21 g/mol |
| Exact Mass | 747.32 |
| IUPAC Name | 4-[3,6,8-tris(4-trimethylsilylphenyl)pyren-1-yl]benzonitrile |
| SMILES | C[Si](C)(C)c1ccc(-c2cc(-c3ccc(C#N)cc3)c3ccc4c(-c5ccc([Si](C)(C)C)cc5)cc(-c5ccc([Si](C)(C)C)cc5)c5ccc2c3c45)cc1 |
| InChI | InChI=1S/C50H49NSi3/c1-52(2,3)38-20-14-35(15-21-38)46-30-45(34-12-10-33(32-51)11-13-34)41-26-27-43-47(36-16-22-39(23-17-36)53(4,5)6)31-48(44-29-28-42(46)49(41)50(43)44)37-18-24-40(25-19-37)54(7,8)9/h10-31H,1-9H3 |
| InChIKey | BWAJPIRKNYKYTL-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.21 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|