C62H54N4Si2 — CID 140615338
4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]-4,8-diphenylnaphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile (PubChem CID 140615338) has the molecular formula C62H54N4Si2 and a molecular weight of 911.31 g/mol. Its IUPAC name is 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]-4,8-diphenylnaphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile.
| Compound Name | 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]-4,8-diphenylnaphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile |
|---|---|
| PubChem CID | 140615338 |
| Molecular Formula | C62H54N4Si2 |
| Molecular Weight | 911.31 g/mol |
| Exact Mass | 910.39 |
| IUPAC Name | 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]-4,8-diphenylnaphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(/C=C/c3cc(-c4ccccc4)c4cc(N(c5ccc(C#N)cc5)c5ccc([Si](C)(C)C)cc5)cc(-c5ccccc5)c4c3)cc2)c2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C62H54N4Si2/c1-64-50-24-30-53(31-25-50)65(54-32-36-57(37-33-54)67(2,3)4)51-26-20-45(21-27-51)18-19-47-40-59(48-14-10-8-11-15-48)62-43-56(42-60(61(62)41-47)49-16-12-9-13-17-49)66(52-28-22-46(44-63)23-29-52)55-34-38-58(39-35-55)68(5,6)7/h8-43H,2-7H3/b19-18+ |
| InChIKey | BZDCSWQSEJSYOM-VHEBQXMUSA-N |
| XLogP | 16.80 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.31 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|