C50H46N4Si2 — CID 123343861
4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile (PubChem CID 123343861) has the molecular formula C50H46N4Si2 and a molecular weight of 759.12 g/mol. Its IUPAC name is 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile.
| Compound Name | 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile |
|---|---|
| PubChem CID | 123343861 |
| Molecular Formula | C50H46N4Si2 |
| Molecular Weight | 759.12 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | 4-(N-[6-[(E)-2-[4-(4-isocyano-N-(4-trimethylsilylphenyl)anilino)phenyl]ethenyl]naphthalen-2-yl]-4-trimethylsilylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(/C=C/c3ccc4cc(N(c5ccc(C#N)cc5)c5ccc([Si](C)(C)C)cc5)ccc4c3)cc2)c2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H46N4Si2/c1-52-42-17-24-45(25-18-42)53(46-26-30-49(31-27-46)55(2,3)4)43-19-11-37(12-20-43)8-9-38-10-15-41-35-48(23-16-40(41)34-38)54(44-21-13-39(36-51)14-22-44)47-28-32-50(33-29-47)56(5,6)7/h8-35H,2-7H3/b9-8+ |
| InChIKey | NKVCWHRUHBTNTI-CMDGGOBGSA-N |
| XLogP | 13.46 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.12 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|