C56H36N4 — CID 140926325
4-[[6-[(E)-2-[6-(4-isocyano-N-naphthalen-2-ylanilino)naphthalen-2-yl]ethenyl]naphthalen-2-yl]-naphthalen-2-ylamino]benzonitrile (PubChem CID 140926325) has the molecular formula C56H36N4 and a molecular weight of 764.93 g/mol. Its IUPAC name is 4-[[6-[(E)-2-[6-(4-isocyano-N-naphthalen-2-ylanilino)naphthalen-2-yl]ethenyl]naphthalen-2-yl]-naphthalen-2-ylamino]benzonitrile.
| Compound Name | 4-[[6-[(E)-2-[6-(4-isocyano-N-naphthalen-2-ylanilino)naphthalen-2-yl]ethenyl]naphthalen-2-yl]-naphthalen-2-ylamino]benzonitrile |
|---|---|
| PubChem CID | 140926325 |
| Molecular Formula | C56H36N4 |
| Molecular Weight | 764.93 g/mol |
| Exact Mass | 764.29 |
| IUPAC Name | 4-[[6-[(E)-2-[6-(4-isocyano-N-naphthalen-2-ylanilino)naphthalen-2-yl]ethenyl]naphthalen-2-yl]-naphthalen-2-ylamino]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc3ccccc3c2)c2ccc3cc(/C=C/c4ccc5cc(N(c6ccc(C#N)cc6)c6ccc7ccccc7c6)ccc5c4)ccc3c2)cc1 |
| InChI | InChI=1S/C56H36N4/c1-58-50-22-30-52(31-23-50)60(54-27-19-43-7-3-5-9-45(43)35-54)56-29-21-47-33-40(13-17-49(47)37-56)11-10-39-12-16-48-36-55(28-20-46(48)32-39)59(51-24-14-41(38-57)15-25-51)53-26-18-42-6-2-4-8-44(42)34-53/h2-37H/b11-10+ |
| InChIKey | OBZHNEAPORMNLY-ZHACJKMWSA-N |
| XLogP | 15.83 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.93 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|