C50H30N4 — CID 70909439
4-[7-(4-cyanophenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthrolin-4-yl]benzonitrile (PubChem CID 70909439) has the molecular formula C50H30N4 and a molecular weight of 686.82 g/mol. Its IUPAC name is 4-[7-(4-cyanophenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthrolin-4-yl]benzonitrile.
| Compound Name | 4-[7-(4-cyanophenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthrolin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 70909439 |
| Molecular Formula | C50H30N4 |
| Molecular Weight | 686.82 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 4-[7-(4-cyanophenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthrolin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc3c2ccc2c(-c4ccc(C#N)cc4)cc(-c4ccc(-c5ccccc5)cc4)nc23)cc1 |
| InChI | InChI=1S/C50H30N4/c51-31-33-11-15-39(16-12-33)45-29-47(41-23-19-37(20-24-41)35-7-3-1-4-8-35)53-49-43(45)27-28-44-46(40-17-13-34(32-52)14-18-40)30-48(54-50(44)49)42-25-21-38(22-26-42)36-9-5-2-6-10-36/h1-30H |
| InChIKey | ASZCVOATKKVRDH-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.82 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|