C56H48N2 — CID 70909450
4,7-bis(4-tert-butylphenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthroline (PubChem CID 70909450) has the molecular formula C56H48N2 and a molecular weight of 749.01 g/mol. Its IUPAC name is 4,7-bis(4-tert-butylphenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthroline.
| Compound Name | 4,7-bis(4-tert-butylphenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 70909450 |
| Molecular Formula | C56H48N2 |
| Molecular Weight | 749.01 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | 4,7-bis(4-tert-butylphenyl)-2,9-bis(4-phenylphenyl)-1,10-phenanthroline |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc3c2ccc2c(-c4ccc(C(C)(C)C)cc4)cc(-c4ccc(-c5ccccc5)cc4)nc23)cc1 |
| InChI | InChI=1S/C56H48N2/c1-55(2,3)45-29-25-41(26-30-45)49-35-51(43-21-17-39(18-22-43)37-13-9-7-10-14-37)57-53-47(49)33-34-48-50(42-27-31-46(32-28-42)56(4,5)6)36-52(58-54(48)53)44-23-19-40(20-24-44)38-15-11-8-12-16-38/h7-36H,1-6H3 |
| InChIKey | LIWFGFUUOSGOEB-UHFFFAOYSA-N |
| XLogP | 15.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.01 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|