C58H48N2 — CID 177454464
2-(4-tert-butylphenyl)-10-[2-(4-tert-butylphenyl)-4-phenylbenzo[g]quinolin-10-yl]-4-phenylbenzo[g]quinoline (PubChem CID 177454464) has the molecular formula C58H48N2 and a molecular weight of 773.04 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-10-[2-(4-tert-butylphenyl)-4-phenylbenzo[g]quinolin-10-yl]-4-phenylbenzo[g]quinoline.
| Compound Name | 2-(4-tert-butylphenyl)-10-[2-(4-tert-butylphenyl)-4-phenylbenzo[g]quinolin-10-yl]-4-phenylbenzo[g]quinoline |
|---|---|
| PubChem CID | 177454464 |
| Molecular Formula | C58H48N2 |
| Molecular Weight | 773.04 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 2-(4-tert-butylphenyl)-10-[2-(4-tert-butylphenyl)-4-phenylbenzo[g]quinolin-10-yl]-4-phenylbenzo[g]quinoline |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccccc3)c3cc4ccccc4c(-c4c5ccccc5cc5c(-c6ccccc6)cc(-c6ccc(C(C)(C)C)cc6)nc45)c3n2)cc1 |
| InChI | InChI=1S/C58H48N2/c1-57(2,3)43-29-25-39(26-30-43)51-35-47(37-17-9-7-10-18-37)49-33-41-21-13-15-23-45(41)53(55(49)59-51)54-46-24-16-14-22-42(46)34-50-48(38-19-11-8-12-20-38)36-52(60-56(50)54)40-27-31-44(32-28-40)58(4,5)6/h7-36H,1-6H3 |
| InChIKey | BOGOCJIOMBZGOE-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.04 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|