C30H31I — CID 141284541
2,3-bis(4-tert-butylphenyl)-1-iodonaphthalene (PubChem CID 141284541) has the molecular formula C30H31I and a molecular weight of 518.48 g/mol. Its IUPAC name is 2,3-bis(4-tert-butylphenyl)-1-iodonaphthalene.
| Compound Name | 2,3-bis(4-tert-butylphenyl)-1-iodonaphthalene |
|---|---|
| PubChem CID | 141284541 |
| Molecular Formula | C30H31I |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2,3-bis(4-tert-butylphenyl)-1-iodonaphthalene |
| SMILES | CC(C)(C)c1ccc(-c2cc3ccccc3c(I)c2-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H31I/c1-29(2,3)23-15-11-20(12-16-23)26-19-22-9-7-8-10-25(22)28(31)27(26)21-13-17-24(18-14-21)30(4,5)6/h7-19H,1-6H3 |
| InChIKey | LPJBFMBQYTXOJV-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|