C44H46N+ — CID 58321082
10,16-bis(4-tert-butylphenyl)-13,13-dimethyl-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 58321082) has the molecular formula C44H46N+ and a molecular weight of 588.86 g/mol. Its IUPAC name is 10,16-bis(4-tert-butylphenyl)-13,13-dimethyl-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 10,16-bis(4-tert-butylphenyl)-13,13-dimethyl-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 58321082 |
| Molecular Formula | C44H46N+ |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | 10,16-bis(4-tert-butylphenyl)-13,13-dimethyl-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CC(C)(C)c1ccc(-c2cc3ccccc3c3c2C[N+](C)(C)Cc2c(-c4ccc(C(C)(C)C)cc4)cc4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C44H46N/c1-43(2,3)33-21-17-29(18-22-33)37-25-31-13-9-11-15-35(31)41-39(37)27-45(7,8)28-40-38(26-32-14-10-12-16-36(32)42(40)41)30-19-23-34(24-20-30)44(4,5)6/h9-26H,27-28H2,1-8H3/q+1 |
| InChIKey | TXCLBNRVWIASCU-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|