C54H50BrN — CID 11228121
13,13-dibutyl-10,16-bis(4-phenylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide (PubChem CID 11228121) has the molecular formula C54H50BrN and a molecular weight of 792.91 g/mol. Its IUPAC name is 13,13-dibutyl-10,16-bis(4-phenylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide.
| Compound Name | 13,13-dibutyl-10,16-bis(4-phenylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide |
|---|---|
| PubChem CID | 11228121 |
| Molecular Formula | C54H50BrN |
| Molecular Weight | 792.91 g/mol |
| Exact Mass | 791.31 |
| IUPAC Name | 13,13-dibutyl-10,16-bis(4-phenylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene bromide |
| SMILES | CCCC[N+]1(CCCC)Cc2c(-c3ccc(-c4ccccc4)cc3)cc3ccccc3c2-c2c(c(-c3ccc(-c4ccccc4)cc3)cc3ccccc23)C1.[Br-] |
| InChI | InChI=1S/C54H50N.BrH/c1-3-5-33-55(34-6-4-2)37-51-49(43-29-25-41(26-30-43)39-17-9-7-10-18-39)35-45-21-13-15-23-47(45)53(51)54-48-24-16-14-22-46(48)36-50(52(54)38-55)44-31-27-42(28-32-44)40-19-11-8-12-20-40;/h7-32,35-36H,3-6,33-34,37-38H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QJYUNGWXNKBTDT-UHFFFAOYSA-M |
| XLogP | 11.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.91 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|