C38H31N3O4 — CID 134405281
13-butyl-10,16-bis(4-nitrophenyl)-13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 134405281) has the molecular formula C38H31N3O4 and a molecular weight of 593.68 g/mol. Its IUPAC name is 13-butyl-10,16-bis(4-nitrophenyl)-13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-butyl-10,16-bis(4-nitrophenyl)-13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 134405281 |
| Molecular Formula | C38H31N3O4 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 13-butyl-10,16-bis(4-nitrophenyl)-13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CCCCN1Cc2c(-c3ccc([N+](=O)[O-])cc3)cc3ccccc3c2-c2c(c(-c3ccc([N+](=O)[O-])cc3)cc3ccccc23)C1 |
| InChI | InChI=1S/C38H31N3O4/c1-2-3-20-39-23-35-33(25-12-16-29(17-13-25)40(42)43)21-27-8-4-6-10-31(27)37(35)38-32-11-7-5-9-28(32)22-34(36(38)24-39)26-14-18-30(19-15-26)41(44)45/h4-19,21-22H,2-3,20,23-24H2,1H3 |
| InChIKey | UZWJWWQTYFLLKE-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|