C44H46NO4S2+ — CID 11297316
13,13-dibutyl-10,16-bis(4-methylsulfonylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 11297316) has the molecular formula C44H46NO4S2+ and a molecular weight of 716.99 g/mol. Its IUPAC name is 13,13-dibutyl-10,16-bis(4-methylsulfonylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13,13-dibutyl-10,16-bis(4-methylsulfonylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 11297316 |
| Molecular Formula | C44H46NO4S2+ |
| Molecular Weight | 716.99 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | 13,13-dibutyl-10,16-bis(4-methylsulfonylphenyl)-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | CCCC[N+]1(CCCC)Cc2c(-c3ccc(S(C)(=O)=O)cc3)cc3ccccc3c2-c2c(c(-c3ccc(S(C)(=O)=O)cc3)cc3ccccc23)C1 |
| InChI | InChI=1S/C44H46NO4S2/c1-5-7-25-45(26-8-6-2)29-41-39(31-17-21-35(22-18-31)50(3,46)47)27-33-13-9-11-15-37(33)43(41)44-38-16-12-10-14-34(38)28-40(42(44)30-45)32-19-23-36(24-20-32)51(4,48)49/h9-24,27-28H,5-8,25-26,29-30H2,1-4H3/q+1 |
| InChIKey | AUFUMFJERJJTKA-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.99 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|