C44H42F6NO2+ — CID 163464146
13,13-dibutyl-10,16-bis[4-(trifluoromethoxy)phenyl]-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3,5,7,9,17,19,21-nonaene (PubChem CID 163464146) has the molecular formula C44H42F6NO2+ and a molecular weight of 730.81 g/mol. Its IUPAC name is 13,13-dibutyl-10,16-bis[4-(trifluoromethoxy)phenyl]-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3,5,7,9,17,19,21-nonaene.
| Compound Name | 13,13-dibutyl-10,16-bis[4-(trifluoromethoxy)phenyl]-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3,5,7,9,17,19,21-nonaene |
|---|---|
| PubChem CID | 163464146 |
| Molecular Formula | C44H42F6NO2+ |
| Molecular Weight | 730.81 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | 13,13-dibutyl-10,16-bis[4-(trifluoromethoxy)phenyl]-13-azoniapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(23),2(11),3,5,7,9,17,19,21-nonaene |
| SMILES | CCCC[N+]1(CCCC)Cc2c(-c3ccc(OC(F)(F)F)cc3)cc3ccccc3c2C2=c3ccccc3=CC(c3ccc(OC(F)(F)F)cc3)C2C1 |
| InChI | InChI=1S/C44H42F6NO2/c1-3-5-23-51(24-6-4-2)27-39-37(29-15-19-33(20-16-29)52-43(45,46)47)25-31-11-7-9-13-35(31)41(39)42-36-14-10-8-12-32(36)26-38(40(42)28-51)30-17-21-34(22-18-30)53-44(48,49)50/h7-22,25-26,37,39H,3-6,23-24,27-28H2,1-2H3/q+1 |
| InChIKey | KRGHUNCNDFMTLD-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.81 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|