C25H29F3O — CID 54294379
2-[4-(2-methylidenepentyl)cyclohexyl]-1-phenyl-4-(trifluoromethoxy)benzene (PubChem CID 54294379) has the molecular formula C25H29F3O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[4-(2-methylidenepentyl)cyclohexyl]-1-phenyl-4-(trifluoromethoxy)benzene.
| Compound Name | 2-[4-(2-methylidenepentyl)cyclohexyl]-1-phenyl-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54294379 |
| Molecular Formula | C25H29F3O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[4-(2-methylidenepentyl)cyclohexyl]-1-phenyl-4-(trifluoromethoxy)benzene |
| SMILES | C=C(CCC)CC1CCC(c2cc(OC(F)(F)F)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29F3O/c1-3-7-18(2)16-19-10-12-21(13-11-19)24-17-22(29-25(26,27)28)14-15-23(24)20-8-5-4-6-9-20/h4-6,8-9,14-15,17,19,21H,2-3,7,10-13,16H2,1H3 |
| InChIKey | RZTRBNZMDFOIDG-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|