C25H27F5 — CID 22131655
1,3-difluoro-5-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene (PubChem CID 22131655) has the molecular formula C25H27F5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22131655 |
| Molecular Formula | C25H27F5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1,3-difluoro-5-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-2-(trifluoromethyl)benzene |
| SMILES | C=C(CC)CCC1CCC(c2ccccc2-c2cc(F)c(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H27F5/c1-3-16(2)8-9-17-10-12-18(13-11-17)20-6-4-5-7-21(20)19-14-22(26)24(23(27)15-19)25(28,29)30/h4-7,14-15,17-18H,2-3,8-13H2,1H3 |
| InChIKey | GEGQDZITUNLFQX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|