C25H28F4 — CID 22131663
2-fluoro-4-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-1-(trifluoromethyl)benzene (PubChem CID 22131663) has the molecular formula C25H28F4 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-fluoro-4-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22131663 |
| Molecular Formula | C25H28F4 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-fluoro-4-[2-[4-(3-methylidenepentyl)cyclohexyl]phenyl]-1-(trifluoromethyl)benzene |
| SMILES | C=C(CC)CCC1CCC(c2ccccc2-c2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C25H28F4/c1-3-17(2)8-9-18-10-12-19(13-11-18)21-6-4-5-7-22(21)20-14-15-23(24(26)16-20)25(27,28)29/h4-7,14-16,18-19H,2-3,8-13H2,1H3 |
| InChIKey | BLYJUGVJLNFSFN-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|