C19H24F4O2 — CID 67790473
[3-fluoro-4-(trifluoromethyl)phenyl] 3-(4-propylcyclohexyl)propanoate (PubChem CID 67790473) has the molecular formula C19H24F4O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl] 3-(4-propylcyclohexyl)propanoate.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl] 3-(4-propylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 67790473 |
| Molecular Formula | C19H24F4O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl] 3-(4-propylcyclohexyl)propanoate |
| SMILES | CCCC1CCC(CCC(=O)Oc2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H24F4O2/c1-2-3-13-4-6-14(7-5-13)8-11-18(24)25-15-9-10-16(17(20)12-15)19(21,22)23/h9-10,12-14H,2-8,11H2,1H3 |
| InChIKey | YLZCLPPMLNPDOK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|