C19H26F2O2 — CID 67789718
(3,4-difluorophenyl) 3-(4-butylcyclohexyl)propanoate (PubChem CID 67789718) has the molecular formula C19H26F2O2 and a molecular weight of 324.41 g/mol. Its IUPAC name is (3,4-difluorophenyl) 3-(4-butylcyclohexyl)propanoate.
| Compound Name | (3,4-difluorophenyl) 3-(4-butylcyclohexyl)propanoate |
|---|---|
| PubChem CID | 67789718 |
| Molecular Formula | C19H26F2O2 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3,4-difluorophenyl) 3-(4-butylcyclohexyl)propanoate |
| SMILES | CCCCC1CCC(CCC(=O)Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H26F2O2/c1-2-3-4-14-5-7-15(8-6-14)9-12-19(22)23-16-10-11-17(20)18(21)13-16/h10-11,13-15H,2-9,12H2,1H3 |
| InChIKey | CEEUQWVBVUWFPA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|