C24H35FO2 — CID 67790563
(4-fluorophenyl) 3-[(3S)-3-(4-propylcyclohexyl)cyclohexyl]propanoate (PubChem CID 67790563) has the molecular formula C24H35FO2 and a molecular weight of 374.54 g/mol. Its IUPAC name is (4-fluorophenyl) 3-[(3S)-3-(4-propylcyclohexyl)cyclohexyl]propanoate.
| Compound Name | (4-fluorophenyl) 3-[(3S)-3-(4-propylcyclohexyl)cyclohexyl]propanoate |
|---|---|
| PubChem CID | 67790563 |
| Molecular Formula | C24H35FO2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (4-fluorophenyl) 3-[(3S)-3-(4-propylcyclohexyl)cyclohexyl]propanoate |
| SMILES | CCCC1CCC([C@H]2CCCC(CCC(=O)Oc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C24H35FO2/c1-2-4-18-7-10-20(11-8-18)21-6-3-5-19(17-21)9-16-24(26)27-23-14-12-22(25)13-15-23/h12-15,18-21H,2-11,16-17H2,1H3/t18?,19?,20?,21-/m0/s1 |
| InChIKey | SOGPBKUFCSYATH-FNNAPWSISA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|