C19H36 — CID 18640232
trans-(1R,3R)-1-butyl-3-(4-propylcyclohexyl)cyclohexane (PubChem CID 18640232) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is trans-(1R,3R)-1-butyl-3-(4-propylcyclohexyl)cyclohexane.
| Compound Name | trans-(1R,3R)-1-butyl-3-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 18640232 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | trans-(1R,3R)-1-butyl-3-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC[C@@H]1CCC[C@@H](C2CCC(CCC)CC2)C1 |
| InChI | InChI=1S/C19H36/c1-3-5-8-17-9-6-10-19(15-17)18-13-11-16(7-4-2)12-14-18/h16-19H,3-15H2,1-2H3/t16?,17-,18?,19-/m1/s1 |
| InChIKey | ADFSZTVIFIISMO-JWHDQAAXSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |