C22H42 — CID 18640305
trans-(1R,3R)-1-heptyl-3-(4-propylcyclohexyl)cyclohexane (PubChem CID 18640305) has the molecular formula C22H42 and a molecular weight of 306.58 g/mol. Its IUPAC name is trans-(1R,3R)-1-heptyl-3-(4-propylcyclohexyl)cyclohexane.
| Compound Name | trans-(1R,3R)-1-heptyl-3-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 18640305 |
| Molecular Formula | C22H42 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 306.33 |
| IUPAC Name | trans-(1R,3R)-1-heptyl-3-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCCCCC[C@@H]1CCC[C@@H](C2CCC(CCC)CC2)C1 |
| InChI | InChI=1S/C22H42/c1-3-5-6-7-8-11-20-12-9-13-22(18-20)21-16-14-19(10-4-2)15-17-21/h19-22H,3-18H2,1-2H3/t19?,20-,21?,22-/m1/s1 |
| InChIKey | KGDNMYWAQXQASR-JYAXOCDNSA-N |
| XLogP | 7.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|