C27H36F4O3 — CID 58555433
[3-fluoro-4-(trifluoromethyl)phenyl] 4-[4-(5-propyloxolan-2-yl)cyclohexyl]cyclohexane-1-carboxylate (PubChem CID 58555433) has the molecular formula C27H36F4O3 and a molecular weight of 484.57 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethyl)phenyl] 4-[4-(5-propyloxolan-2-yl)cyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | [3-fluoro-4-(trifluoromethyl)phenyl] 4-[4-(5-propyloxolan-2-yl)cyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58555433 |
| Molecular Formula | C27H36F4O3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [3-fluoro-4-(trifluoromethyl)phenyl] 4-[4-(5-propyloxolan-2-yl)cyclohexyl]cyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C2CCC(C3CCC(C(=O)Oc4ccc(C(F)(F)F)c(F)c4)CC3)CC2)O1 |
| InChI | InChI=1S/C27H36F4O3/c1-2-3-21-13-15-25(33-21)19-8-4-17(5-9-19)18-6-10-20(11-7-18)26(32)34-22-12-14-23(24(28)16-22)27(29,30)31/h12,14,16-21,25H,2-11,13,15H2,1H3 |
| InChIKey | SGIFGRSGSADSBC-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|