C26H37FO2 — CID 139868816
(3-fluoro-4-methylphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate (PubChem CID 139868816) has the molecular formula C26H37FO2 and a molecular weight of 400.58 g/mol. Its IUPAC name is (3-fluoro-4-methylphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate.
| Compound Name | (3-fluoro-4-methylphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139868816 |
| Molecular Formula | C26H37FO2 |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (3-fluoro-4-methylphenyl) 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)cyclohexane-1-carboxylate |
| SMILES | CCC1CCC2CC(C3CCC(C(=O)Oc4ccc(C)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C26H37FO2/c1-3-18-5-6-23-15-22(12-11-21(23)14-18)19-7-9-20(10-8-19)26(28)29-24-13-4-17(2)25(27)16-24/h4,13,16,18-23H,3,5-12,14-15H2,1-2H3 |
| InChIKey | QEQBKMRJZXWTDH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|