C18H25FO3 — CID 23391187
(3-fluoro-4-propoxyphenyl) 4-ethylcyclohexane-1-carboxylate (PubChem CID 23391187) has the molecular formula C18H25FO3 and a molecular weight of 308.39 g/mol. Its IUPAC name is (3-fluoro-4-propoxyphenyl) 4-ethylcyclohexane-1-carboxylate.
| Compound Name | (3-fluoro-4-propoxyphenyl) 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23391187 |
| Molecular Formula | C18H25FO3 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3-fluoro-4-propoxyphenyl) 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCCOc1ccc(OC(=O)C2CCC(CC)CC2)cc1F |
| InChI | InChI=1S/C18H25FO3/c1-3-11-21-17-10-9-15(12-16(17)19)22-18(20)14-7-5-13(4-2)6-8-14/h9-10,12-14H,3-8,11H2,1-2H3 |
| InChIKey | VUWBNZBMBUTOEG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|