C22H21F5O2 — CID 54263129
[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl] 4-ethylcyclohexane-1-carboxylate (PubChem CID 54263129) has the molecular formula C22H21F5O2 and a molecular weight of 412.40 g/mol. Its IUPAC name is [4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl] 4-ethylcyclohexane-1-carboxylate.
| Compound Name | [4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl] 4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54263129 |
| Molecular Formula | C22H21F5O2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl] 4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(C(=O)Oc2ccc(-c3cc(F)c(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H21F5O2/c1-2-13-3-5-15(6-4-13)21(28)29-17-9-7-14(8-10-17)16-11-18(23)20(19(24)12-16)22(25,26)27/h7-13,15H,2-6H2,1H3 |
| InChIKey | REXDZOKJIKGFJE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|