About [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate
[4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 70378138) has the molecular formula C22H22F2O2
and a molecular weight of 356.41 g/mol. Its IUPAC name is [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate |
| PubChem CID | 70378138 |
| Molecular Formula | C22H22F2O2 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC1CCC(C(=O)Oc2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H22F2O2/c1-2-3-15-4-6-17(7-5-15)22(25)26-19-11-8-16(9-12-19)18-10-13-20(23)21(24)14-18/h2,8-15,17H,1,3-7H2 |
| InChIKey | GCZSHJFEMINOBS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate?
The IUPAC name of [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate (CID 70378138) is [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate.
What is the SMILES notation for [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate?
The canonical SMILES for [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate is C=CCC1CCC(C(=O)Oc2ccc(-c3ccc(F)c(F)c3)cc2)CC1.
What is the InChIKey of [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate?
The InChIKey is GCZSHJFEMINOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2O2/c1-2-3-15-4-6-17(7-5-15)22(25)26-19-11-8-16(9-12-19)18-10-13-20(23)21(24)14-18/h2,8-15,17H,1,3-7H2.
What are the key properties of [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate?
[4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate has a molecular weight of 356.41 g/mol, XLogP of 5.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-difluorophenyl)phenyl] 4-prop-2-enylcyclohexane-1-carboxylate is sourced from PubChem (CID 70378138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).