C25H29F3O — CID 22131651
1-[4-(3-methylidenepentyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 22131651) has the molecular formula C25H29F3O and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[4-(3-methylidenepentyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-[4-(3-methylidenepentyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 22131651 |
| Molecular Formula | C25H29F3O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[4-(3-methylidenepentyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | C=C(CC)CCC1CCC(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H29F3O/c1-3-18(2)4-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)23-14-16-24(17-15-23)29-25(26,27)28/h10-17,19-20H,2-9H2,1H3 |
| InChIKey | FXTXKCCVWMGJAP-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|