C24H35F3O2 — CID 22908550
1-[2-(4-propylcyclohexyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]cyclohexan-1-ol (PubChem CID 22908550) has the molecular formula C24H35F3O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-[2-(4-propylcyclohexyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]cyclohexan-1-ol.
| Compound Name | 1-[2-(4-propylcyclohexyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 22908550 |
| Molecular Formula | C24H35F3O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1-[2-(4-propylcyclohexyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]cyclohexan-1-ol |
| SMILES | CCCC1CCC(CCC2(O)CCC(c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H35F3O2/c1-2-3-18-4-6-19(7-5-18)12-15-23(28)16-13-21(14-17-23)20-8-10-22(11-9-20)29-24(25,26)27/h8-11,18-19,21,28H,2-7,12-17H2,1H3 |
| InChIKey | ZQTXNYKNFXNNKT-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |