C23H33F3O — CID 15201511
9-pentyl-3-[4-(trifluoromethoxy)phenyl]spiro[5.5]undecane (PubChem CID 15201511) has the molecular formula C23H33F3O and a molecular weight of 382.51 g/mol. Its IUPAC name is 9-pentyl-3-[4-(trifluoromethoxy)phenyl]spiro[5.5]undecane.
| Compound Name | 9-pentyl-3-[4-(trifluoromethoxy)phenyl]spiro[5.5]undecane |
|---|---|
| PubChem CID | 15201511 |
| Molecular Formula | C23H33F3O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 9-pentyl-3-[4-(trifluoromethoxy)phenyl]spiro[5.5]undecane |
| SMILES | CCCCCC1CCC2(CC1)CCC(c1ccc(OC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C23H33F3O/c1-2-3-4-5-18-10-14-22(15-11-18)16-12-20(13-17-22)19-6-8-21(9-7-19)27-23(24,25)26/h6-9,18,20H,2-5,10-17H2,1H3 |
| InChIKey | ITLHWUWBFHPBPE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|