C16H14F4 — CID 122488056
2-fluoro-4-(2-propylphenyl)-1-(trifluoromethyl)benzene (PubChem CID 122488056) has the molecular formula C16H14F4 and a molecular weight of 282.28 g/mol. Its IUPAC name is 2-fluoro-4-(2-propylphenyl)-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-(2-propylphenyl)-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 122488056 |
| Molecular Formula | C16H14F4 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-fluoro-4-(2-propylphenyl)-1-(trifluoromethyl)benzene |
| SMILES | CCCc1ccccc1-c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C16H14F4/c1-2-5-11-6-3-4-7-13(11)12-8-9-14(15(17)10-12)16(18,19)20/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | HYJFGYUCWUAEDC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |