C25H30F4 — CID 22437537
4-[4-[2-(4-butylcyclohexyl)ethyl]phenyl]-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 22437537) has the molecular formula C25H30F4 and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-[4-[2-(4-butylcyclohexyl)ethyl]phenyl]-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-[4-[2-(4-butylcyclohexyl)ethyl]phenyl]-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 22437537 |
| Molecular Formula | C25H30F4 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-[4-[2-(4-butylcyclohexyl)ethyl]phenyl]-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | CCCCC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H30F4/c1-2-3-4-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)22-15-16-23(24(26)17-22)25(27,28)29/h11-19H,2-10H2,1H3 |
| InChIKey | OLJBICWQLCAAAL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |