C21H28F6O — CID 90179533
1-[difluoro(trifluoromethoxy)methyl]-2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzene (PubChem CID 90179533) has the molecular formula C21H28F6O and a molecular weight of 410.44 g/mol. Its IUPAC name is 1-[difluoro(trifluoromethoxy)methyl]-2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzene.
| Compound Name | 1-[difluoro(trifluoromethoxy)methyl]-2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzene |
|---|---|
| PubChem CID | 90179533 |
| Molecular Formula | C21H28F6O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[difluoro(trifluoromethoxy)methyl]-2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]benzene |
| SMILES | CCCCCC1CCC(CCc2ccc(C(F)(F)OC(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H28F6O/c1-2-3-4-5-15-6-8-16(9-7-15)10-11-17-12-13-18(19(22)14-17)20(23,24)28-21(25,26)27/h12-16H,2-11H2,1H3 |
| InChIKey | NXFYJMIAOFTITR-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|