C26H29F5 — CID 19695475
2-fluoro-4-[4-[2-[4-[(E)-5-fluoropent-3-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene (PubChem CID 19695475) has the molecular formula C26H29F5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-fluoro-4-[4-[2-[4-[(E)-5-fluoropent-3-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-[4-[2-[4-[(E)-5-fluoropent-3-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 19695475 |
| Molecular Formula | C26H29F5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-fluoro-4-[4-[2-[4-[(E)-5-fluoropent-3-enyl]cyclohexyl]ethyl]phenyl]-1-(trifluoromethyl)benzene |
| SMILES | FC/C=C/CCC1CCC(CCc2ccc(-c3ccc(C(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H29F5/c27-17-3-1-2-4-19-5-7-20(8-6-19)9-10-21-11-13-22(14-12-21)23-15-16-24(25(28)18-23)26(29,30)31/h1,3,11-16,18-20H,2,4-10,17H2/b3-1+ |
| InChIKey | IUJHBTFBJDWJAM-HNQUOIGGSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|