C17H14F4 — CID 139764150
4-(4-but-3-enylphenyl)-2-fluoro-1-(trifluoromethyl)benzene (PubChem CID 139764150) has the molecular formula C17H14F4 and a molecular weight of 294.29 g/mol. Its IUPAC name is 4-(4-but-3-enylphenyl)-2-fluoro-1-(trifluoromethyl)benzene.
| Compound Name | 4-(4-but-3-enylphenyl)-2-fluoro-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139764150 |
| Molecular Formula | C17H14F4 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(4-but-3-enylphenyl)-2-fluoro-1-(trifluoromethyl)benzene |
| SMILES | C=CCCc1ccc(-c2ccc(C(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H14F4/c1-2-3-4-12-5-7-13(8-6-12)14-9-10-15(16(18)11-14)17(19,20)21/h2,5-11H,1,3-4H2 |
| InChIKey | IWTCWTOIHLCZNW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|