C33H23F5 — CID 68533355
2-but-3-enyl-6-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene (PubChem CID 68533355) has the molecular formula C33H23F5 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene.
| Compound Name | 2-but-3-enyl-6-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 68533355 |
| Molecular Formula | C33H23F5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-but-3-enyl-6-[4-[4-[3,5-difluoro-4-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene |
| SMILES | C=CCCc1ccc2cc(-c3ccc(-c4ccc(-c5cc(F)c(C(F)(F)F)c(F)c5)cc4)cc3)ccc2c1 |
| InChI | InChI=1S/C33H23F5/c1-2-3-4-21-5-6-28-18-27(16-15-26(28)17-21)24-11-7-22(8-12-24)23-9-13-25(14-10-23)29-19-30(34)32(31(35)20-29)33(36,37)38/h2,5-20H,1,3-4H2 |
| InChIKey | USFZAQHZAYDWFA-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|