C33H22F6 — CID 87933948
2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[2-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene (PubChem CID 87933948) has the molecular formula C33H22F6 and a molecular weight of 532.53 g/mol. Its IUPAC name is 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[2-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene.
| Compound Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[2-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 87933948 |
| Molecular Formula | C33H22F6 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[2-(trifluoromethyl)phenyl]phenyl]phenyl]naphthalene |
| SMILES | C=CCCc1ccc2cc(-c3cc(F)c(-c4ccc(-c5ccccc5C(F)(F)F)c(F)c4)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C33H22F6/c1-2-3-6-20-9-10-22-16-23(12-11-21(22)15-20)25-18-30(35)32(31(36)19-25)24-13-14-27(29(34)17-24)26-7-4-5-8-28(26)33(37,38)39/h2,4-5,7-19H,1,3,6H2 |
| InChIKey | JPUFVGNPZOJUDB-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|