C23H17F3 — CID 138459100
2-(4-but-3-enylphenyl)-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138459100) has the molecular formula C23H17F3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-(4-but-3-enylphenyl)-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 2-(4-but-3-enylphenyl)-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138459100 |
| Molecular Formula | C23H17F3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(4-but-3-enylphenyl)-6-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | C=CCCc1ccc(-c2ccc3cc(C#CC(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C23H17F3/c1-2-3-4-17-5-8-19(9-6-17)21-12-11-20-15-18(7-10-22(20)16-21)13-14-23(24,25)26/h2,5-12,15-16H,1,3-4H2 |
| InChIKey | KJVWRTZWUZHAAZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|