C20H26FN — CID 54111541
4-[2-[4-(5-fluoropent-3-enyl)cyclohexyl]ethyl]benzonitrile (PubChem CID 54111541) has the molecular formula C20H26FN and a molecular weight of 299.43 g/mol. Its IUPAC name is 4-[2-[4-(5-fluoropent-3-enyl)cyclohexyl]ethyl]benzonitrile.
| Compound Name | 4-[2-[4-(5-fluoropent-3-enyl)cyclohexyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 54111541 |
| Molecular Formula | C20H26FN |
| Molecular Weight | 299.43 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-[2-[4-(5-fluoropent-3-enyl)cyclohexyl]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCC2CCC(CCC=CCF)CC2)cc1 |
| InChI | InChI=1S/C20H26FN/c21-15-3-1-2-4-17-5-7-18(8-6-17)9-10-19-11-13-20(16-22)14-12-19/h1,3,11-14,17-18H,2,4-10,15H2 |
| InChIKey | NHLQLTIMBGNLBK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|