C22H31N — CID 54469260
5-[4-[2-(4-propylphenyl)ethyl]cyclohexyl]pent-2-enenitrile (PubChem CID 54469260) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is 5-[4-[2-(4-propylphenyl)ethyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | 5-[4-[2-(4-propylphenyl)ethyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 54469260 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 5-[4-[2-(4-propylphenyl)ethyl]cyclohexyl]pent-2-enenitrile |
| SMILES | CCCc1ccc(CCC2CCC(CCC=CC#N)CC2)cc1 |
| InChI | InChI=1S/C22H31N/c1-2-6-19-8-12-21(13-9-19)16-17-22-14-10-20(11-15-22)7-4-3-5-18-23/h3,5,8-9,12-13,20,22H,2,4,6-7,10-11,14-17H2,1H3 |
| InChIKey | XHDHVBQOYVRTNG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|