C28H41NO — CID 57290169
5-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]pent-2-enenitrile (PubChem CID 57290169) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is 5-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | 5-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 57290169 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | 5-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]pent-2-enenitrile |
| SMILES | CCCCc1ccc(C2CCC(C(O)C3CCC(CCC=CC#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H41NO/c1-2-3-7-22-9-13-24(14-10-22)25-17-19-27(20-18-25)28(30)26-15-11-23(12-16-26)8-5-4-6-21-29/h4,6,9-10,13-14,23,25-28,30H,2-3,5,7-8,11-12,15-20H2,1H3 |
| InChIKey | WNQBELYEMBPZBI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|