C27H39NO — CID 57211449
3-[4-[hydroxy-[4-(4-pentylphenyl)cyclohexyl]methyl]cyclohexyl]prop-2-enenitrile (PubChem CID 57211449) has the molecular formula C27H39NO and a molecular weight of 393.62 g/mol. Its IUPAC name is 3-[4-[hydroxy-[4-(4-pentylphenyl)cyclohexyl]methyl]cyclohexyl]prop-2-enenitrile.
| Compound Name | 3-[4-[hydroxy-[4-(4-pentylphenyl)cyclohexyl]methyl]cyclohexyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 57211449 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | 3-[4-[hydroxy-[4-(4-pentylphenyl)cyclohexyl]methyl]cyclohexyl]prop-2-enenitrile |
| SMILES | CCCCCc1ccc(C2CCC(C(O)C3CCC(C=CC#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H39NO/c1-2-3-4-6-21-8-12-23(13-9-21)24-16-18-26(19-17-24)27(29)25-14-10-22(11-15-25)7-5-20-28/h5,7-9,12-13,22,24-27,29H,2-4,6,10-11,14-19H2,1H3 |
| InChIKey | VEJYCOYIHLNCOH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|