C30H43NO — CID 57229631
7-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 57229631) has the molecular formula C30H43NO and a molecular weight of 433.68 g/mol. Its IUPAC name is 7-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | 7-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 57229631 |
| Molecular Formula | C30H43NO |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | 7-[4-[[4-(4-butylphenyl)cyclohexyl]-hydroxymethyl]cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | CCCCc1ccc(C2CCC(C(O)C3CCC(CCC=CC=CC#N)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H43NO/c1-2-3-9-24-11-15-26(16-12-24)27-19-21-29(22-20-27)30(32)28-17-13-25(14-18-28)10-7-5-4-6-8-23-31/h4-6,8,11-12,15-16,25,27-30,32H,2-3,7,9-10,13-14,17-22H2,1H3 |
| InChIKey | HEZHXCKHIMRFPA-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|