C23H31N — CID 19613144
(2E,4E)-7-[4-(4-butylphenyl)cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 19613144) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is (2E,4E)-7-[4-(4-butylphenyl)cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | (2E,4E)-7-[4-(4-butylphenyl)cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 19613144 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (2E,4E)-7-[4-(4-butylphenyl)cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | CCCCc1ccc(C2CCC(CC/C=C/C=C/C#N)CC2)cc1 |
| InChI | InChI=1S/C23H31N/c1-2-3-9-20-11-15-22(16-12-20)23-17-13-21(14-18-23)10-7-5-4-6-8-19-24/h4-6,8,11-12,15-16,21,23H,2-3,7,9-10,13-14,17-18H2,1H3/b5-4+,8-6+ |
| InChIKey | LAGLZUHCDSHDAR-DVBIZMGNSA-N |
| XLogP | 6.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|