C27H36FN — CID 19613894
(2E,4E)-7-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]hepta-2,4-dienenitrile (PubChem CID 19613894) has the molecular formula C27H36FN and a molecular weight of 393.59 g/mol. Its IUPAC name is (2E,4E)-7-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]hepta-2,4-dienenitrile.
| Compound Name | (2E,4E)-7-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]hepta-2,4-dienenitrile |
|---|---|
| PubChem CID | 19613894 |
| Molecular Formula | C27H36FN |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | (2E,4E)-7-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]hepta-2,4-dienenitrile |
| SMILES | N#C/C=C/C=C/CCC1CCC(CCC2CCC(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H36FN/c28-27-19-17-26(18-20-27)25-15-13-24(14-16-25)12-11-23-9-7-22(8-10-23)6-4-2-1-3-5-21-29/h1-3,5,17-20,22-25H,4,6-16H2/b2-1+,5-3+ |
| InChIKey | KWCPQJQIFBNKDB-NRNIAZNESA-N |
| XLogP | 8.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|