C24H30N2 — CID 54106459
4-[4-[4-(4-cyanobut-3-enyl)cyclohexyl]cyclohexyl]benzonitrile (PubChem CID 54106459) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 4-[4-[4-(4-cyanobut-3-enyl)cyclohexyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[4-(4-cyanobut-3-enyl)cyclohexyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54106459 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 4-[4-[4-(4-cyanobut-3-enyl)cyclohexyl]cyclohexyl]benzonitrile |
| SMILES | N#CC=CCCC1CCC(C2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H30N2/c25-17-3-1-2-4-19-5-9-21(10-6-19)23-13-15-24(16-14-23)22-11-7-20(18-26)8-12-22/h1,3,7-8,11-12,19,21,23-24H,2,4-6,9-10,13-16H2 |
| InChIKey | NECBBRXVKYUYAR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|