C25H33F2N — CID 67590863
(Z)-2-fluoro-5-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]pent-2-enenitrile (PubChem CID 67590863) has the molecular formula C25H33F2N and a molecular weight of 385.54 g/mol. Its IUPAC name is (Z)-2-fluoro-5-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]pent-2-enenitrile.
| Compound Name | (Z)-2-fluoro-5-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 67590863 |
| Molecular Formula | C25H33F2N |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (Z)-2-fluoro-5-[4-[2-[4-(4-fluorophenyl)cyclohexyl]ethyl]cyclohexyl]pent-2-enenitrile |
| SMILES | N#C/C(F)=C/CCC1CCC(CCC2CCC(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H33F2N/c26-24-16-14-23(15-17-24)22-12-10-21(11-13-22)9-8-20-6-4-19(5-7-20)2-1-3-25(27)18-28/h3,14-17,19-22H,1-2,4-13H2/b25-3- |
| InChIKey | FSXPJPNNEPLVAL-GYEZCXOLSA-N |
| XLogP | 7.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|