C25H31FN2O — CID 54125534
4-[4-[[4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl]oxymethyl]cyclohexyl]benzonitrile (PubChem CID 54125534) has the molecular formula C25H31FN2O and a molecular weight of 394.53 g/mol. Its IUPAC name is 4-[4-[[4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl]oxymethyl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[[4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl]oxymethyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 54125534 |
| Molecular Formula | C25H31FN2O |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 4-[4-[[4-(4-cyano-4-fluorobut-3-enyl)cyclohexyl]oxymethyl]cyclohexyl]benzonitrile |
| SMILES | N#CC(F)=CCCC1CCC(OCC2CCC(c3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H31FN2O/c26-24(17-28)3-1-2-19-8-14-25(15-9-19)29-18-21-6-12-23(13-7-21)22-10-4-20(16-27)5-11-22/h3-5,10-11,19,21,23,25H,1-2,6-9,12-15,18H2 |
| InChIKey | NQRWEHCGWZRAFC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|