C24H30F3NO — CID 67590331
(Z)-5-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]-2-fluoropent-2-enenitrile (PubChem CID 67590331) has the molecular formula C24H30F3NO and a molecular weight of 405.50 g/mol. Its IUPAC name is (Z)-5-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]-2-fluoropent-2-enenitrile.
| Compound Name | (Z)-5-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]-2-fluoropent-2-enenitrile |
|---|---|
| PubChem CID | 67590331 |
| Molecular Formula | C24H30F3NO |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (Z)-5-[4-[[4-(3,4-difluorophenyl)cyclohexyl]methoxy]cyclohexyl]-2-fluoropent-2-enenitrile |
| SMILES | N#C/C(F)=C/CCC1CCC(OCC2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H30F3NO/c25-21(15-28)3-1-2-17-6-11-22(12-7-17)29-16-18-4-8-19(9-5-18)20-10-13-23(26)24(27)14-20/h3,10,13-14,17-19,22H,1-2,4-9,11-12,16H2/b21-3- |
| InChIKey | QECZFDVUFXRCCU-OSSHXBFKSA-N |
| XLogP | 6.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|